About naphthalene-1,2,7-triamine
naphthalene-1,2,7-triamine (PubChem CID 19078044) has the molecular formula C10H11N3
and a molecular weight of 173.22 g/mol. Its IUPAC name is naphthalene-1,2,7-triamine.
Molecular Properties
| Compound Name | naphthalene-1,2,7-triamine |
| PubChem CID | 19078044 |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.22 g/mol |
| Exact Mass | 173.10 |
| IUPAC Name | naphthalene-1,2,7-triamine |
| SMILES | Nc1ccc2ccc(N)c(N)c2c1 |
| InChI | InChI=1S/C10H11N3/c11-7-3-1-6-2-4-9(12)10(13)8(6)5-7/h1-5H,11-13H2 |
| InChIKey | CNCIGUOYJQKMCN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.22 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze naphthalene-1,2,7-triamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of naphthalene-1,2,7-triamine?
The IUPAC name of naphthalene-1,2,7-triamine (CID 19078044) is naphthalene-1,2,7-triamine.
What is the SMILES notation for naphthalene-1,2,7-triamine?
The canonical SMILES for naphthalene-1,2,7-triamine is Nc1ccc2ccc(N)c(N)c2c1.
What is the InChIKey of naphthalene-1,2,7-triamine?
The InChIKey is CNCIGUOYJQKMCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11N3/c11-7-3-1-6-2-4-9(12)10(13)8(6)5-7/h1-5H,11-13H2.
What are the key properties of naphthalene-1,2,7-triamine?
naphthalene-1,2,7-triamine has a molecular weight of 173.22 g/mol, XLogP of 1.59, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for naphthalene-1,2,7-triamine is sourced from PubChem (CID 19078044), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).