About 1-sulfanylprop-2-yn-1-ol
1-sulfanylprop-2-yn-1-ol (PubChem CID 19078213) has the molecular formula C3H4OS
and a molecular weight of 88.13 g/mol. Its IUPAC name is 1-sulfanylprop-2-yn-1-ol.
Molecular Properties
| Compound Name | 1-sulfanylprop-2-yn-1-ol |
| PubChem CID | 19078213 |
| Molecular Formula | C3H4OS |
| Molecular Weight | 88.13 g/mol |
| Exact Mass | 88.00 |
| IUPAC Name | 1-sulfanylprop-2-yn-1-ol |
| SMILES | C#CC(O)S |
| InChI | InChI=1S/C3H4OS/c1-2-3(4)5/h1,3-5H |
| InChIKey | PBJAGAKJFRBOKM-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.13 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylprop-2-yn-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylprop-2-yn-1-ol?
The IUPAC name of 1-sulfanylprop-2-yn-1-ol (CID 19078213) is 1-sulfanylprop-2-yn-1-ol.
What is the SMILES notation for 1-sulfanylprop-2-yn-1-ol?
The canonical SMILES for 1-sulfanylprop-2-yn-1-ol is C#CC(O)S.
What is the InChIKey of 1-sulfanylprop-2-yn-1-ol?
The InChIKey is PBJAGAKJFRBOKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4OS/c1-2-3(4)5/h1,3-5H.
What are the key properties of 1-sulfanylprop-2-yn-1-ol?
1-sulfanylprop-2-yn-1-ol has a molecular weight of 88.13 g/mol, XLogP of -0.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylprop-2-yn-1-ol is sourced from PubChem (CID 19078213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).