About 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine
3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine (PubChem CID 19078392) has the molecular formula C16H20N2S
and a molecular weight of 272.42 g/mol. Its IUPAC name is 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine.
Molecular Properties
| Compound Name | 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine |
| PubChem CID | 19078392 |
| Molecular Formula | C16H20N2S |
| Molecular Weight | 272.42 g/mol |
| Exact Mass | 272.13 |
| IUPAC Name | 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine |
| SMILES | CCc1c[nH]c2ccc(-c3cccs3)cc12.CNC |
| InChI | InChI=1S/C14H13NS.C2H7N/c1-2-10-9-15-13-6-5-11(8-12(10)13)14-4-3-7-16-14;1-3-2/h3-9,15H,2H2,1H3;3H,1-2H3 |
| InChIKey | UTKDJTGXXOZNIU-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.42 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine?
The IUPAC name of 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine (CID 19078392) is 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine.
What is the SMILES notation for 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine?
The canonical SMILES for 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine is CCc1c[nH]c2ccc(-c3cccs3)cc12.CNC.
What is the InChIKey of 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine?
The InChIKey is UTKDJTGXXOZNIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13NS.C2H7N/c1-2-10-9-15-13-6-5-11(8-12(10)13)14-4-3-7-16-14;1-3-2/h3-9,15H,2H2,1H3;3H,1-2H3.
What are the key properties of 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine?
3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine has a molecular weight of 272.42 g/mol, XLogP of 4.29, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-thiophen-2-yl-1H-indole;N-methylmethanamine is sourced from PubChem (CID 19078392), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).