C13H16Br2O — CID 19078602
5-bromo-2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran (PubChem CID 19078602) has the molecular formula C13H16Br2O and a molecular weight of 348.08 g/mol. Its IUPAC name is 5-bromo-2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran.
| Compound Name | 5-bromo-2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran |
|---|---|
| PubChem CID | 19078602 |
| Molecular Formula | C13H16Br2O |
| Molecular Weight | 348.08 g/mol |
| Exact Mass | 345.96 |
| IUPAC Name | 5-bromo-2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran |
| SMILES | Cc1c(C)c2c(c(C)c1Br)CC(C)(CBr)O2 |
| InChI | InChI=1S/C13H16Br2O/c1-7-8(2)12-10(9(3)11(7)15)5-13(4,6-14)16-12/h5-6H2,1-4H3 |
| InChIKey | CAJVVHRKENYPOQ-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.08 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|