C28H27ClN4O3 — CID 19078720
11-(4-chlorophenyl)-5-hexyl-8-phenacyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione (PubChem CID 19078720) has the molecular formula C28H27ClN4O3 and a molecular weight of 503.00 g/mol. Its IUPAC name is 11-(4-chlorophenyl)-5-hexyl-8-phenacyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione.
| Compound Name | 11-(4-chlorophenyl)-5-hexyl-8-phenacyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione |
|---|---|
| PubChem CID | 19078720 |
| Molecular Formula | C28H27ClN4O3 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.18 |
| IUPAC Name | 11-(4-chlorophenyl)-5-hexyl-8-phenacyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),9,11-triene-2,6-dione |
| SMILES | CCCCCCN1Cc2c(n(CC(=O)c3ccccc3)c3cc(-c4ccc(Cl)cc4)nn3c2=O)C1=O |
| InChI | InChI=1S/C28H27ClN4O3/c1-2-3-4-8-15-31-17-22-26(28(31)36)32(18-24(34)20-9-6-5-7-10-20)25-16-23(30-33(25)27(22)35)19-11-13-21(29)14-12-19/h5-7,9-14,16H,2-4,8,15,17-18H2,1H3 |
| InChIKey | JRKQSQSFAJCTBQ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 76.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|