About 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine
3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine (PubChem CID 19079387) has the molecular formula C12H7ClF3N
and a molecular weight of 257.64 g/mol. Its IUPAC name is 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine.
Molecular Properties
| Compound Name | 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine |
| PubChem CID | 19079387 |
| Molecular Formula | C12H7ClF3N |
| Molecular Weight | 257.64 g/mol |
| Exact Mass | 257.02 |
| IUPAC Name | 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine |
| SMILES | Fc1cc(-c2cncc(CCl)c2)cc(F)c1F |
| InChI | InChI=1S/C12H7ClF3N/c13-4-7-1-9(6-17-5-7)8-2-10(14)12(16)11(15)3-8/h1-3,5-6H,4H2 |
| InChIKey | HZLRAKIGCDSPIA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.64 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine?
The IUPAC name of 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine (CID 19079387) is 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine.
What is the SMILES notation for 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine?
The canonical SMILES for 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine is Fc1cc(-c2cncc(CCl)c2)cc(F)c1F.
What is the InChIKey of 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine?
The InChIKey is HZLRAKIGCDSPIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7ClF3N/c13-4-7-1-9(6-17-5-7)8-2-10(14)12(16)11(15)3-8/h1-3,5-6H,4H2.
What are the key properties of 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine?
3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine has a molecular weight of 257.64 g/mol, XLogP of 3.90, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)-5-(3,4,5-trifluorophenyl)pyridine is sourced from PubChem (CID 19079387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).