About [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine
[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine (PubChem CID 19079501) has the molecular formula C11H12F3NO
and a molecular weight of 231.22 g/mol. Its IUPAC name is [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine.
Molecular Properties
| Compound Name | [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine |
| PubChem CID | 19079501 |
| Molecular Formula | C11H12F3NO |
| Molecular Weight | 231.22 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine |
| SMILES | NCC1CCc2cc(C(F)(F)F)ccc2O1 |
| InChI | InChI=1S/C11H12F3NO/c12-11(13,14)8-2-4-10-7(5-8)1-3-9(6-15)16-10/h2,4-5,9H,1,3,6,15H2 |
| InChIKey | OVUHGTNSFHCUDV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine?
The IUPAC name of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine (CID 19079501) is [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine.
What is the SMILES notation for [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine?
The canonical SMILES for [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine is NCC1CCc2cc(C(F)(F)F)ccc2O1.
What is the InChIKey of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine?
The InChIKey is OVUHGTNSFHCUDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12F3NO/c12-11(13,14)8-2-4-10-7(5-8)1-3-9(6-15)16-10/h2,4-5,9H,1,3,6,15H2.
What are the key properties of [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine?
[6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine has a molecular weight of 231.22 g/mol, XLogP of 2.36, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [6-(trifluoromethyl)-3,4-dihydro-2H-chromen-2-yl]methanamine is sourced from PubChem (CID 19079501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).