C6H9N3O3S — CID 19079993
1-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione (PubChem CID 19079993) has the molecular formula C6H9N3O3S and a molecular weight of 203.22 g/mol. Its IUPAC name is 1-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19079993 |
| Molecular Formula | C6H9N3O3S |
| Molecular Weight | 203.22 g/mol |
| Exact Mass | 203.04 |
| IUPAC Name | 1-(3-sulfanylpropyl)-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCCS)c(=O)[nH]1 |
| InChI | InChI=1S/C6H9N3O3S/c10-4-7-5(11)9(2-1-3-13)6(12)8-4/h13H,1-3H2,(H2,7,8,10,11,12) |
| InChIKey | IYEMURBHQIAVFC-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.22 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|