C5H7N3O3S3 — CID 19079997
1-[2,2,2-tris(sulfanyl)ethyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 19079997) has the molecular formula C5H7N3O3S3 and a molecular weight of 253.33 g/mol. Its IUPAC name is 1-[2,2,2-tris(sulfanyl)ethyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-[2,2,2-tris(sulfanyl)ethyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 19079997 |
| Molecular Formula | C5H7N3O3S3 |
| Molecular Weight | 253.33 g/mol |
| Exact Mass | 252.96 |
| IUPAC Name | 1-[2,2,2-tris(sulfanyl)ethyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CC(S)(S)S)c(=O)[nH]1 |
| InChI | InChI=1S/C5H7N3O3S3/c9-2-6-3(10)8(4(11)7-2)1-5(12,13)14/h12-14H,1H2,(H2,6,7,9,10,11) |
| InChIKey | MTQNVGKRYPKIIK-UHFFFAOYSA-N |
| XLogP | -1.33 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.33 |
| LogP ≤ 5 | -1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|