About (4-nitronaphthalen-1-yl) hydrogen sulfate
(4-nitronaphthalen-1-yl) hydrogen sulfate (PubChem CID 19080010) has the molecular formula C10H7NO6S
and a molecular weight of 269.23 g/mol. Its IUPAC name is (4-nitronaphthalen-1-yl) hydrogen sulfate.
Molecular Properties
| Compound Name | (4-nitronaphthalen-1-yl) hydrogen sulfate |
| PubChem CID | 19080010 |
| Molecular Formula | C10H7NO6S |
| Molecular Weight | 269.23 g/mol |
| Exact Mass | 269.00 |
| IUPAC Name | (4-nitronaphthalen-1-yl) hydrogen sulfate |
| SMILES | O=[N+]([O-])c1ccc(OS(=O)(=O)O)c2ccccc12 |
| InChI | InChI=1S/C10H7NO6S/c12-11(13)9-5-6-10(17-18(14,15)16)8-4-2-1-3-7(8)9/h1-6H,(H,14,15,16) |
| InChIKey | JWACTFQPNICSOO-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.23 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze (4-nitronaphthalen-1-yl) hydrogen sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitronaphthalen-1-yl) hydrogen sulfate?
The IUPAC name of (4-nitronaphthalen-1-yl) hydrogen sulfate (CID 19080010) is (4-nitronaphthalen-1-yl) hydrogen sulfate.
What is the SMILES notation for (4-nitronaphthalen-1-yl) hydrogen sulfate?
The canonical SMILES for (4-nitronaphthalen-1-yl) hydrogen sulfate is O=[N+]([O-])c1ccc(OS(=O)(=O)O)c2ccccc12.
What is the InChIKey of (4-nitronaphthalen-1-yl) hydrogen sulfate?
The InChIKey is JWACTFQPNICSOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7NO6S/c12-11(13)9-5-6-10(17-18(14,15)16)8-4-2-1-3-7(8)9/h1-6H,(H,14,15,16).
What are the key properties of (4-nitronaphthalen-1-yl) hydrogen sulfate?
(4-nitronaphthalen-1-yl) hydrogen sulfate has a molecular weight of 269.23 g/mol, XLogP of 1.93, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitronaphthalen-1-yl) hydrogen sulfate is sourced from PubChem (CID 19080010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).