About 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one
4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one (PubChem CID 19080100) has the molecular formula C11H15N3O
and a molecular weight of 205.26 g/mol. Its IUPAC name is 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one.
Molecular Properties
| Compound Name | 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one |
| PubChem CID | 19080100 |
| Molecular Formula | C11H15N3O |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one |
| SMILES | CC(C)C1NNC(=O)N1c1ccccc1 |
| InChI | InChI=1S/C11H15N3O/c1-8(2)10-12-13-11(15)14(10)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3,(H,13,15) |
| InChIKey | RYVCDNIUMRNMPY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one?
The IUPAC name of 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one (CID 19080100) is 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one.
What is the SMILES notation for 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one?
The canonical SMILES for 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one is CC(C)C1NNC(=O)N1c1ccccc1.
What is the InChIKey of 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one?
The InChIKey is RYVCDNIUMRNMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3O/c1-8(2)10-12-13-11(15)14(10)9-6-4-3-5-7-9/h3-8,10,12H,1-2H3,(H,13,15).
What are the key properties of 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one?
4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one has a molecular weight of 205.26 g/mol, XLogP of 1.70, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenyl-5-propan-2-yl-1,2,4-triazolidin-3-one is sourced from PubChem (CID 19080100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).