C23H14ClF2NO — CID 19080126
4-[4-[2-(4-chlorophenyl)ethynyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole (PubChem CID 19080126) has the molecular formula C23H14ClF2NO and a molecular weight of 393.82 g/mol. Its IUPAC name is 4-[4-[2-(4-chlorophenyl)ethynyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole.
| Compound Name | 4-[4-[2-(4-chlorophenyl)ethynyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19080126 |
| Molecular Formula | C23H14ClF2NO |
| Molecular Weight | 393.82 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 4-[4-[2-(4-chlorophenyl)ethynyl]phenyl]-2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1cccc(F)c1C1=NC(c2ccc(C#Cc3ccc(Cl)cc3)cc2)CO1 |
| InChI | InChI=1S/C23H14ClF2NO/c24-18-12-8-16(9-13-18)5-4-15-6-10-17(11-7-15)21-14-28-23(27-21)22-19(25)2-1-3-20(22)26/h1-3,6-13,21H,14H2 |
| InChIKey | CZQMINPZJLQXFI-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.82 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|