C23H16F3NO — CID 19080131
2-(2,6-difluorophenyl)-4-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-4,5-dihydro-1,3-oxazole (PubChem CID 19080131) has the molecular formula C23H16F3NO and a molecular weight of 379.38 g/mol. Its IUPAC name is 2-(2,6-difluorophenyl)-4-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-4,5-dihydro-1,3-oxazole.
| Compound Name | 2-(2,6-difluorophenyl)-4-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-4,5-dihydro-1,3-oxazole |
|---|---|
| PubChem CID | 19080131 |
| Molecular Formula | C23H16F3NO |
| Molecular Weight | 379.38 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | 2-(2,6-difluorophenyl)-4-[4-[(E)-2-(4-fluorophenyl)ethenyl]phenyl]-4,5-dihydro-1,3-oxazole |
| SMILES | Fc1ccc(/C=C/c2ccc(C3COC(c4c(F)cccc4F)=N3)cc2)cc1 |
| InChI | InChI=1S/C23H16F3NO/c24-18-12-8-16(9-13-18)5-4-15-6-10-17(11-7-15)21-14-28-23(27-21)22-19(25)2-1-3-20(22)26/h1-13,21H,14H2/b5-4+ |
| InChIKey | WRFCVERTEHSBNM-SNAWJCMRSA-N |
| XLogP | 5.79 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.38 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|