About 4-(hydroxymethyl)-2,6-dipropylphenol
4-(hydroxymethyl)-2,6-dipropylphenol (PubChem CID 19080389) has the molecular formula C13H20O2
and a molecular weight of 208.30 g/mol. Its IUPAC name is 4-(hydroxymethyl)-2,6-dipropylphenol.
Molecular Properties
| Compound Name | 4-(hydroxymethyl)-2,6-dipropylphenol |
| PubChem CID | 19080389 |
| Molecular Formula | C13H20O2 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.15 |
| IUPAC Name | 4-(hydroxymethyl)-2,6-dipropylphenol |
| SMILES | CCCc1cc(CO)cc(CCC)c1O |
| InChI | InChI=1S/C13H20O2/c1-3-5-11-7-10(9-14)8-12(6-4-2)13(11)15/h7-8,14-15H,3-6,9H2,1-2H3 |
| InChIKey | LPUXDXOGPQWBJM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(hydroxymethyl)-2,6-dipropylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(hydroxymethyl)-2,6-dipropylphenol?
The IUPAC name of 4-(hydroxymethyl)-2,6-dipropylphenol (CID 19080389) is 4-(hydroxymethyl)-2,6-dipropylphenol.
What is the SMILES notation for 4-(hydroxymethyl)-2,6-dipropylphenol?
The canonical SMILES for 4-(hydroxymethyl)-2,6-dipropylphenol is CCCc1cc(CO)cc(CCC)c1O.
What is the InChIKey of 4-(hydroxymethyl)-2,6-dipropylphenol?
The InChIKey is LPUXDXOGPQWBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O2/c1-3-5-11-7-10(9-14)8-12(6-4-2)13(11)15/h7-8,14-15H,3-6,9H2,1-2H3.
What are the key properties of 4-(hydroxymethyl)-2,6-dipropylphenol?
4-(hydroxymethyl)-2,6-dipropylphenol has a molecular weight of 208.30 g/mol, XLogP of 2.79, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(hydroxymethyl)-2,6-dipropylphenol is sourced from PubChem (CID 19080389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).