About 3-ethenyl-1,4-dimethyl-2H-imidazole
3-ethenyl-1,4-dimethyl-2H-imidazole (PubChem CID 19080528) has the molecular formula C7H12N2
and a molecular weight of 124.19 g/mol. Its IUPAC name is 3-ethenyl-1,4-dimethyl-2H-imidazole.
Molecular Properties
| Compound Name | 3-ethenyl-1,4-dimethyl-2H-imidazole |
| PubChem CID | 19080528 |
| Molecular Formula | C7H12N2 |
| Molecular Weight | 124.19 g/mol |
| Exact Mass | 124.10 |
| IUPAC Name | 3-ethenyl-1,4-dimethyl-2H-imidazole |
| SMILES | C=CN1CN(C)C=C1C |
| InChI | InChI=1S/C7H12N2/c1-4-9-6-8(3)5-7(9)2/h4-5H,1,6H2,2-3H3 |
| InChIKey | CXTIFDOBSYIQBP-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.19 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-ethenyl-1,4-dimethyl-2H-imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethenyl-1,4-dimethyl-2H-imidazole?
The IUPAC name of 3-ethenyl-1,4-dimethyl-2H-imidazole (CID 19080528) is 3-ethenyl-1,4-dimethyl-2H-imidazole.
What is the SMILES notation for 3-ethenyl-1,4-dimethyl-2H-imidazole?
The canonical SMILES for 3-ethenyl-1,4-dimethyl-2H-imidazole is C=CN1CN(C)C=C1C.
What is the InChIKey of 3-ethenyl-1,4-dimethyl-2H-imidazole?
The InChIKey is CXTIFDOBSYIQBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2/c1-4-9-6-8(3)5-7(9)2/h4-5H,1,6H2,2-3H3.
What are the key properties of 3-ethenyl-1,4-dimethyl-2H-imidazole?
3-ethenyl-1,4-dimethyl-2H-imidazole has a molecular weight of 124.19 g/mol, XLogP of 1.20, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethenyl-1,4-dimethyl-2H-imidazole is sourced from PubChem (CID 19080528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).