About 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol
2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol (PubChem CID 19080618) has the molecular formula C12H24O4S
and a molecular weight of 264.39 g/mol. Its IUPAC name is 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol.
Molecular Properties
| Compound Name | 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol |
| PubChem CID | 19080618 |
| Molecular Formula | C12H24O4S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol |
| SMILES | OCCSC(CO)C1(CO)CCC(CO)CC1 |
| InChI | InChI=1S/C12H24O4S/c13-5-6-17-11(8-15)12(9-16)3-1-10(7-14)2-4-12/h10-11,13-16H,1-9H2 |
| InChIKey | KPUJTOUVQCIQRZ-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol?
The IUPAC name of 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol (CID 19080618) is 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol.
What is the SMILES notation for 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol?
The canonical SMILES for 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol is OCCSC(CO)C1(CO)CCC(CO)CC1.
What is the InChIKey of 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol?
The InChIKey is KPUJTOUVQCIQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24O4S/c13-5-6-17-11(8-15)12(9-16)3-1-10(7-14)2-4-12/h10-11,13-16H,1-9H2.
What are the key properties of 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol?
2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol has a molecular weight of 264.39 g/mol, XLogP of 0.23, 7 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,4-bis(hydroxymethyl)cyclohexyl]-2-(2-hydroxyethylsulfanyl)ethanol is sourced from PubChem (CID 19080618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).