About 3-methylpyrazolidin-1-ium 1-oxide
3-methylpyrazolidin-1-ium 1-oxide (PubChem CID 19080638) has the molecular formula C4H9N2O+
and a molecular weight of 101.13 g/mol. Its IUPAC name is 3-methylpyrazolidin-1-ium 1-oxide.
Molecular Properties
| Compound Name | 3-methylpyrazolidin-1-ium 1-oxide |
| PubChem CID | 19080638 |
| Molecular Formula | C4H9N2O+ |
| Molecular Weight | 101.13 g/mol |
| Exact Mass | 101.07 |
| IUPAC Name | 3-methylpyrazolidin-1-ium 1-oxide |
| SMILES | CC1CC[N+](=O)N1 |
| InChI | InChI=1S/C4H9N2O/c1-4-2-3-6(7)5-4/h4H,2-3H2,1H3,(H,5,7)/q+1 |
| InChIKey | CSAUXKYMMNILLF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 32.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.13 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylpyrazolidin-1-ium 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylpyrazolidin-1-ium 1-oxide?
The IUPAC name of 3-methylpyrazolidin-1-ium 1-oxide (CID 19080638) is 3-methylpyrazolidin-1-ium 1-oxide.
What is the SMILES notation for 3-methylpyrazolidin-1-ium 1-oxide?
The canonical SMILES for 3-methylpyrazolidin-1-ium 1-oxide is CC1CC[N+](=O)N1.
What is the InChIKey of 3-methylpyrazolidin-1-ium 1-oxide?
The InChIKey is CSAUXKYMMNILLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9N2O/c1-4-2-3-6(7)5-4/h4H,2-3H2,1H3,(H,5,7)/q+1.
What are the key properties of 3-methylpyrazolidin-1-ium 1-oxide?
3-methylpyrazolidin-1-ium 1-oxide has a molecular weight of 101.13 g/mol, XLogP of 0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylpyrazolidin-1-ium 1-oxide is sourced from PubChem (CID 19080638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).