About N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine
N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine (PubChem CID 19082398) has the molecular formula C14H18N2O
and a molecular weight of 230.31 g/mol. Its IUPAC name is N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine.
Molecular Properties
| Compound Name | N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine |
| PubChem CID | 19082398 |
| Molecular Formula | C14H18N2O |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.14 |
| IUPAC Name | N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine |
| SMILES | CCN(CC)c1conc1-c1cccc(C)c1 |
| InChI | InChI=1S/C14H18N2O/c1-4-16(5-2)13-10-17-15-14(13)12-8-6-7-11(3)9-12/h6-10H,4-5H2,1-3H3 |
| InChIKey | BACKRNYGYLMVEL-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine?
The IUPAC name of N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine (CID 19082398) is N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine.
What is the SMILES notation for N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine?
The canonical SMILES for N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine is CCN(CC)c1conc1-c1cccc(C)c1.
What is the InChIKey of N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine?
The InChIKey is BACKRNYGYLMVEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O/c1-4-16(5-2)13-10-17-15-14(13)12-8-6-7-11(3)9-12/h6-10H,4-5H2,1-3H3.
What are the key properties of N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine?
N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine has a molecular weight of 230.31 g/mol, XLogP of 3.50, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-(3-methylphenyl)-1,2-oxazol-4-amine is sourced from PubChem (CID 19082398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).