About 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate
1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate (PubChem CID 19083216) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate.
Molecular Properties
| Compound Name | 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate |
| PubChem CID | 19083216 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate |
| SMILES | CNC(=O)OC(C)CN(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H22N2O2/c1-10-6-11(2)8-13(7-10)16(5)9-12(3)18-14(17)15-4/h6-8,12H,9H2,1-5H3,(H,15,17) |
| InChIKey | XDIIOLIFZDMGHX-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate?
The IUPAC name of 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate (CID 19083216) is 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate.
What is the SMILES notation for 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate?
The canonical SMILES for 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate is CNC(=O)OC(C)CN(C)c1cc(C)cc(C)c1.
What is the InChIKey of 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate?
The InChIKey is XDIIOLIFZDMGHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-10-6-11(2)8-13(7-10)16(5)9-12(3)18-14(17)15-4/h6-8,12H,9H2,1-5H3,(H,15,17).
What are the key properties of 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate?
1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate has a molecular weight of 250.34 g/mol, XLogP of 2.48, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(N,3,5-trimethylanilino)propan-2-yl N-methylcarbamate is sourced from PubChem (CID 19083216), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).