2-hydroxybenzenesulfonyl chloride

C6H5ClO3S — CID 19083293

IUPAC2-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccccc1O
InChIInChI=1S/C6H5ClO3S/c7-11(9,10)6-4-2-1-3-5(6)8/h1-4,8H
InChIKeyVUGOTOYGNLHWPK-UHFFFAOYSA-N
MW192.62 g/mol
LogP1.32
Rot. Bonds1

About 2-hydroxybenzenesulfonyl chloride

2-hydroxybenzenesulfonyl chloride (PubChem CID 19083293) has the molecular formula C6H5ClO3S and a molecular weight of 192.62 g/mol. Its IUPAC name is 2-hydroxybenzenesulfonyl chloride.

Molecular Properties

Compound Name2-hydroxybenzenesulfonyl chloride
PubChem CID19083293
Molecular FormulaC6H5ClO3S
Molecular Weight192.62 g/mol
Exact Mass191.96
IUPAC Name2-hydroxybenzenesulfonyl chloride
SMILESO=S(=O)(Cl)c1ccccc1O
InChIInChI=1S/C6H5ClO3S/c7-11(9,10)6-4-2-1-3-5(6)8/h1-4,8H
InChIKeyVUGOTOYGNLHWPK-UHFFFAOYSA-N
XLogP1.32
TPSA54.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500192.62
LogP ≤ 51.32
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-hydroxybenzenesulfonyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-hydroxybenzenesulfonyl chloride?
The IUPAC name of 2-hydroxybenzenesulfonyl chloride (CID 19083293) is 2-hydroxybenzenesulfonyl chloride.
What is the SMILES notation for 2-hydroxybenzenesulfonyl chloride?
The canonical SMILES for 2-hydroxybenzenesulfonyl chloride is O=S(=O)(Cl)c1ccccc1O.
What is the InChIKey of 2-hydroxybenzenesulfonyl chloride?
The InChIKey is VUGOTOYGNLHWPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5ClO3S/c7-11(9,10)6-4-2-1-3-5(6)8/h1-4,8H.
What are the key properties of 2-hydroxybenzenesulfonyl chloride?
2-hydroxybenzenesulfonyl chloride has a molecular weight of 192.62 g/mol, XLogP of 1.32, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzenesulfonyl chloride is sourced from PubChem (CID 19083293), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).