C14H8ClFN2O6S — CID 19083408
4,8-diamino-6-chloro-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonyl fluoride (PubChem CID 19083408) has the molecular formula C14H8ClFN2O6S and a molecular weight of 386.74 g/mol. Its IUPAC name is 4,8-diamino-6-chloro-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonyl fluoride.
| Compound Name | 4,8-diamino-6-chloro-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonyl fluoride |
|---|---|
| PubChem CID | 19083408 |
| Molecular Formula | C14H8ClFN2O6S |
| Molecular Weight | 386.74 g/mol |
| Exact Mass | 385.98 |
| IUPAC Name | 4,8-diamino-6-chloro-1,5-dihydroxy-9,10-dioxoanthracene-2-sulfonyl fluoride |
| SMILES | Nc1cc(Cl)c(O)c2c1C(=O)c1c(O)c(S(=O)(=O)F)cc(N)c1C2=O |
| InChI | InChI=1S/C14H8ClFN2O6S/c15-3-1-4(17)7-9(11(3)19)13(21)8-5(18)2-6(25(16,23)24)12(20)10(8)14(7)22/h1-2,19-20H,17-18H2 |
| InChIKey | PECBGXMXUOACNP-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 160.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.74 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|