C24H24N2O — CID 19083791
1,3,3,7,9'-pentamethylspiro[indole-2,2'-pyrano[3,2-h]quinoline] (PubChem CID 19083791) has the molecular formula C24H24N2O and a molecular weight of 356.47 g/mol. Its IUPAC name is 1,3,3,7,9'-pentamethylspiro[indole-2,2'-pyrano[3,2-h]quinoline].
| Compound Name | 1,3,3,7,9'-pentamethylspiro[indole-2,2'-pyrano[3,2-h]quinoline] |
|---|---|
| PubChem CID | 19083791 |
| Molecular Formula | C24H24N2O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.19 |
| IUPAC Name | 1,3,3,7,9'-pentamethylspiro[indole-2,2'-pyrano[3,2-h]quinoline] |
| SMILES | Cc1ccc2ccc3c(c2n1)OC1(C=C3)N(C)c2c(C)cccc2C1(C)C |
| InChI | InChI=1S/C24H24N2O/c1-15-7-6-8-19-21(15)26(5)24(23(19,3)4)14-13-18-12-11-17-10-9-16(2)25-20(17)22(18)27-24/h6-14H,1-5H3 |
| InChIKey | NYBVMEWDGITXKT-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |