About 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene]
3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] (PubChem CID 19083828) has the molecular formula C23H18N2O3S
and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene].
Molecular Properties
| Compound Name | 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] |
| PubChem CID | 19083828 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] |
| SMILES | CCN1c2ccccc2SC12Oc1ccc([N+](=O)[O-])cc1C=C2c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3S/c1-2-24-20-10-6-7-11-22(20)29-23(24)19(16-8-4-3-5-9-16)15-17-14-18(25(26)27)12-13-21(17)28-23/h3-15H,2H2,1H3 |
| InChIKey | JTIZABGSXKSTAB-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene]?
The IUPAC name of 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] (CID 19083828) is 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene].
What is the SMILES notation for 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene]?
The canonical SMILES for 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] is CCN1c2ccccc2SC12Oc1ccc([N+](=O)[O-])cc1C=C2c1ccccc1.
What is the InChIKey of 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene]?
The InChIKey is JTIZABGSXKSTAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H18N2O3S/c1-2-24-20-10-6-7-11-22(20)29-23(24)19(16-8-4-3-5-9-16)15-17-14-18(25(26)27)12-13-21(17)28-23/h3-15H,2H2,1H3.
What are the key properties of 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene]?
3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] has a molecular weight of 402.48 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-6'-nitro-3'-phenylspiro[1,3-benzothiazole-2,2'-chromene] is sourced from PubChem (CID 19083828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).