C19H14F4N2O3 — CID 19083834
4',5',6',7'-tetrafluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 19083834) has the molecular formula C19H14F4N2O3 and a molecular weight of 394.32 g/mol. Its IUPAC name is 4',5',6',7'-tetrafluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 4',5',6',7'-tetrafluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19083834 |
| Molecular Formula | C19H14F4N2O3 |
| Molecular Weight | 394.32 g/mol |
| Exact Mass | 394.09 |
| IUPAC Name | 4',5',6',7'-tetrafluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2c(F)c(F)c(F)c(F)c2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C19H14F4N2O3/c1-18(2)12-13(20)14(21)15(22)16(23)17(12)24(3)19(18)7-6-9-8-10(25(26)27)4-5-11(9)28-19/h4-8H,1-3H3 |
| InChIKey | UNIXPCAPHSZVBH-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.32 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|