About 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene]
6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] (PubChem CID 19083870) has the molecular formula C24H20N2O3S
and a molecular weight of 416.50 g/mol. Its IUPAC name is 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene].
Molecular Properties
| Compound Name | 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] |
| PubChem CID | 19083870 |
| Molecular Formula | C24H20N2O3S |
| Molecular Weight | 416.50 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] |
| SMILES | CCCN1c2ccccc2SC12Oc1ccc([N+](=O)[O-])cc1C=C2c1ccccc1 |
| InChI | InChI=1S/C24H20N2O3S/c1-2-14-25-21-10-6-7-11-23(21)30-24(25)20(17-8-4-3-5-9-17)16-18-15-19(26(27)28)12-13-22(18)29-24/h3-13,15-16H,2,14H2,1H3 |
| InChIKey | RXTRBOVYHTWYID-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 416.50 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene]?
The IUPAC name of 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] (CID 19083870) is 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene].
What is the SMILES notation for 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene]?
The canonical SMILES for 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] is CCCN1c2ccccc2SC12Oc1ccc([N+](=O)[O-])cc1C=C2c1ccccc1.
What is the InChIKey of 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene]?
The InChIKey is RXTRBOVYHTWYID-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H20N2O3S/c1-2-14-25-21-10-6-7-11-23(21)30-24(25)20(17-8-4-3-5-9-17)16-18-15-19(26(27)28)12-13-22(18)29-24/h3-13,15-16H,2,14H2,1H3.
What are the key properties of 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene]?
6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] has a molecular weight of 416.50 g/mol, XLogP of 6.20, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6'-nitro-3'-phenyl-3-propylspiro[1,3-benzothiazole-2,2'-chromene] is sourced from PubChem (CID 19083870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).