C21H21ClN2O5 — CID 19083872
7'-chloro-5,7-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 19083872) has the molecular formula C21H21ClN2O5 and a molecular weight of 416.86 g/mol. Its IUPAC name is 7'-chloro-5,7-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
| Compound Name | 7'-chloro-5,7-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19083872 |
| Molecular Formula | C21H21ClN2O5 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | 7'-chloro-5,7-dimethoxy-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | COc1cc2c(c(OC)c1[N+](=O)[O-])C=CC1(O2)N(C)c2c(Cl)cccc2C1(C)C |
| InChI | InChI=1S/C21H21ClN2O5/c1-20(2)13-7-6-8-14(22)17(13)23(3)21(20)10-9-12-15(29-21)11-16(27-4)18(24(25)26)19(12)28-5/h6-11H,1-5H3 |
| InChIKey | YIQDTZYGLUJOLK-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|