About 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]
4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (PubChem CID 19084055) has the molecular formula C19H17FN2O3
and a molecular weight of 340.35 g/mol. Its IUPAC name is 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
Molecular Properties
| Compound Name | 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| PubChem CID | 19084055 |
| Molecular Formula | C19H17FN2O3 |
| Molecular Weight | 340.35 g/mol |
| Exact Mass | 340.12 |
| IUPAC Name | 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] |
| SMILES | CN1c2cccc(F)c2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C19H17FN2O3/c1-18(2)17-14(20)5-4-6-15(17)21(3)19(18)10-9-12-11-13(22(23)24)7-8-16(12)25-19/h4-11H,1-3H3 |
| InChIKey | CXXACUSSEQKUJL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.35 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]?
The IUPAC name of 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] (CID 19084055) is 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole].
What is the SMILES notation for 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]?
The canonical SMILES for 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] is CN1c2cccc(F)c2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2.
What is the InChIKey of 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]?
The InChIKey is CXXACUSSEQKUJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17FN2O3/c1-18(2)17-14(20)5-4-6-15(17)21(3)19(18)10-9-12-11-13(22(23)24)7-8-16(12)25-19/h4-11H,1-3H3.
What are the key properties of 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole]?
4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] has a molecular weight of 340.35 g/mol, XLogP of 4.26, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4'-fluoro-1',3',3'-trimethyl-6-nitrospiro[chromene-2,2'-indole] is sourced from PubChem (CID 19084055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).