C31H26N2O3 — CID 19084090
1',3',3'-trimethyl-6-nitro-4',6'-diphenylspiro[chromene-2,2'-indole] (PubChem CID 19084090) has the molecular formula C31H26N2O3 and a molecular weight of 474.56 g/mol. Its IUPAC name is 1',3',3'-trimethyl-6-nitro-4',6'-diphenylspiro[chromene-2,2'-indole].
| Compound Name | 1',3',3'-trimethyl-6-nitro-4',6'-diphenylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19084090 |
| Molecular Formula | C31H26N2O3 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.19 |
| IUPAC Name | 1',3',3'-trimethyl-6-nitro-4',6'-diphenylspiro[chromene-2,2'-indole] |
| SMILES | CN1c2cc(-c3ccccc3)cc(-c3ccccc3)c2C(C)(C)C12C=Cc1cc([N+](=O)[O-])ccc1O2 |
| InChI | InChI=1S/C31H26N2O3/c1-30(2)29-26(22-12-8-5-9-13-22)19-24(21-10-6-4-7-11-21)20-27(29)32(3)31(30)17-16-23-18-25(33(34)35)14-15-28(23)36-31/h4-20H,1-3H3 |
| InChIKey | ZGDCYLJZJSJFJR-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 55.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|