C19H17Cl2NO — CID 19084092
5,7-dichloro-1',3',3'-trimethylspiro[chromene-2,2'-indole] (PubChem CID 19084092) has the molecular formula C19H17Cl2NO and a molecular weight of 346.26 g/mol. Its IUPAC name is 5,7-dichloro-1',3',3'-trimethylspiro[chromene-2,2'-indole].
| Compound Name | 5,7-dichloro-1',3',3'-trimethylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19084092 |
| Molecular Formula | C19H17Cl2NO |
| Molecular Weight | 346.26 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 5,7-dichloro-1',3',3'-trimethylspiro[chromene-2,2'-indole] |
| SMILES | CN1c2ccccc2C(C)(C)C12C=Cc1c(Cl)cc(Cl)cc1O2 |
| InChI | InChI=1S/C19H17Cl2NO/c1-18(2)14-6-4-5-7-16(14)22(3)19(18)9-8-13-15(21)10-12(20)11-17(13)23-19/h4-11H,1-3H3 |
| InChIKey | WJJXTJUPTJSJSL-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |