C39H34N2O5 — CID 19084426
5,7-dimethoxy-1',3',3'-trimethyl-6-nitro-4',6',7'-triphenylspiro[chromene-2,2'-indole] (PubChem CID 19084426) has the molecular formula C39H34N2O5 and a molecular weight of 610.71 g/mol. Its IUPAC name is 5,7-dimethoxy-1',3',3'-trimethyl-6-nitro-4',6',7'-triphenylspiro[chromene-2,2'-indole].
| Compound Name | 5,7-dimethoxy-1',3',3'-trimethyl-6-nitro-4',6',7'-triphenylspiro[chromene-2,2'-indole] |
|---|---|
| PubChem CID | 19084426 |
| Molecular Formula | C39H34N2O5 |
| Molecular Weight | 610.71 g/mol |
| Exact Mass | 610.25 |
| IUPAC Name | 5,7-dimethoxy-1',3',3'-trimethyl-6-nitro-4',6',7'-triphenylspiro[chromene-2,2'-indole] |
| SMILES | COc1cc2c(c(OC)c1[N+](=O)[O-])C=CC1(O2)N(C)c2c(-c3ccccc3)c(-c3ccccc3)cc(-c3ccccc3)c2C1(C)C |
| InChI | InChI=1S/C39H34N2O5/c1-38(2)34-30(26-17-11-7-12-18-26)23-29(25-15-9-6-10-16-25)33(27-19-13-8-14-20-27)36(34)40(3)39(38)22-21-28-31(46-39)24-32(44-4)35(41(42)43)37(28)45-5/h6-24H,1-5H3 |
| InChIKey | INGZSVCVMLSPDP-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 74.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.71 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|