About spiro[1,3-dihydroindole-2,2'-chromene]
spiro[1,3-dihydroindole-2,2'-chromene] (PubChem CID 19084460) has the molecular formula C16H13NO
and a molecular weight of 235.29 g/mol. Its IUPAC name is spiro[1,3-dihydroindole-2,2'-chromene].
Molecular Properties
| Compound Name | spiro[1,3-dihydroindole-2,2'-chromene] |
| PubChem CID | 19084460 |
| Molecular Formula | C16H13NO |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | spiro[1,3-dihydroindole-2,2'-chromene] |
| SMILES | C1=CC2(Cc3ccccc3N2)Oc2ccccc21 |
| InChI | InChI=1S/C16H13NO/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16/h1-10,17H,11H2 |
| InChIKey | UBJLXPMBVQEKSC-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1,3-dihydroindole-2,2'-chromene] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1,3-dihydroindole-2,2'-chromene]?
The IUPAC name of spiro[1,3-dihydroindole-2,2'-chromene] (CID 19084460) is spiro[1,3-dihydroindole-2,2'-chromene].
What is the SMILES notation for spiro[1,3-dihydroindole-2,2'-chromene]?
The canonical SMILES for spiro[1,3-dihydroindole-2,2'-chromene] is C1=CC2(Cc3ccccc3N2)Oc2ccccc21.
What is the InChIKey of spiro[1,3-dihydroindole-2,2'-chromene]?
The InChIKey is UBJLXPMBVQEKSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO/c1-3-7-14-13(6-1)11-16(17-14)10-9-12-5-2-4-8-15(12)18-16/h1-10,17H,11H2.
What are the key properties of spiro[1,3-dihydroindole-2,2'-chromene]?
spiro[1,3-dihydroindole-2,2'-chromene] has a molecular weight of 235.29 g/mol, XLogP of 3.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1,3-dihydroindole-2,2'-chromene] is sourced from PubChem (CID 19084460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).