C26H23ClN4O2S — CID 19085297
(E)-N-[[4-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]-5-methyl-1,2,4-triazol-3-yl]methyl]-3-phenylprop-2-enamide (PubChem CID 19085297) has the molecular formula C26H23ClN4O2S and a molecular weight of 491.02 g/mol. Its IUPAC name is (E)-N-[[4-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]-5-methyl-1,2,4-triazol-3-yl]methyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[[4-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]-5-methyl-1,2,4-triazol-3-yl]methyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 19085297 |
| Molecular Formula | C26H23ClN4O2S |
| Molecular Weight | 491.02 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | (E)-N-[[4-[3-(2-chlorobenzoyl)-5-ethylthiophen-2-yl]-5-methyl-1,2,4-triazol-3-yl]methyl]-3-phenylprop-2-enamide |
| SMILES | CCc1cc(C(=O)c2ccccc2Cl)c(-n2c(C)nnc2CNC(=O)/C=C/c2ccccc2)s1 |
| InChI | InChI=1S/C26H23ClN4O2S/c1-3-19-15-21(25(33)20-11-7-8-12-22(20)27)26(34-19)31-17(2)29-30-23(31)16-28-24(32)14-13-18-9-5-4-6-10-18/h4-15H,3,16H2,1-2H3,(H,28,32)/b14-13+ |
| InChIKey | ZZOGMJWBLRRYBL-BUHFOSPRSA-N |
| XLogP | 5.41 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.02 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|