About 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine
2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine (PubChem CID 19085398) has the molecular formula C18H28N2O2
and a molecular weight of 304.43 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine.
Molecular Properties
| Compound Name | 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine |
| PubChem CID | 19085398 |
| Molecular Formula | C18H28N2O2 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine |
| SMILES | COc1ccccc1OCCN1CCC(=CCN(C)C)CC1 |
| InChI | InChI=1S/C18H28N2O2/c1-19(2)11-8-16-9-12-20(13-10-16)14-15-22-18-7-5-4-6-17(18)21-3/h4-8H,9-15H2,1-3H3 |
| InChIKey | GWZYQKCAGQXNSE-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine?
The IUPAC name of 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine (CID 19085398) is 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine.
What is the SMILES notation for 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine?
The canonical SMILES for 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine is COc1ccccc1OCCN1CCC(=CCN(C)C)CC1.
What is the InChIKey of 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine?
The InChIKey is GWZYQKCAGQXNSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H28N2O2/c1-19(2)11-8-16-9-12-20(13-10-16)14-15-22-18-7-5-4-6-17(18)21-3/h4-8H,9-15H2,1-3H3.
What are the key properties of 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine?
2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine has a molecular weight of 304.43 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-[2-(2-methoxyphenoxy)ethyl]piperidin-4-ylidene]-N,N-dimethylethanamine is sourced from PubChem (CID 19085398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).