C27H30N4O7S — CID 19085511
2-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide (PubChem CID 19085511) has the molecular formula C27H30N4O7S and a molecular weight of 554.63 g/mol. Its IUPAC name is 2-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide.
| Compound Name | 2-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 19085511 |
| Molecular Formula | C27H30N4O7S |
| Molecular Weight | 554.63 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 2-[4-(4,6-dimethoxypyrimidin-2-yl)phenyl]-N-(3,4-dimethyl-1,2-oxazol-5-yl)-N-(2-methoxyethoxymethyl)benzenesulfonamide |
| SMILES | COCCOCN(c1onc(C)c1C)S(=O)(=O)c1ccccc1-c1ccc(-c2nc(OC)cc(OC)n2)cc1 |
| InChI | InChI=1S/C27H30N4O7S/c1-18-19(2)30-38-27(18)31(17-37-15-14-34-3)39(32,33)23-9-7-6-8-22(23)20-10-12-21(13-11-20)26-28-24(35-4)16-25(29-26)36-5/h6-13,16H,14-15,17H2,1-5H3 |
| InChIKey | PENIGRWKIHQNPO-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 126.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.63 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|