C43H49N3O6 — CID 19085584
4-[3-[4-[(4-methylphenyl)methoxy]-3-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoic acid (PubChem CID 19085584) has the molecular formula C43H49N3O6 and a molecular weight of 703.88 g/mol. Its IUPAC name is 4-[3-[4-[(4-methylphenyl)methoxy]-3-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoic acid.
| Compound Name | 4-[3-[4-[(4-methylphenyl)methoxy]-3-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoic acid |
|---|---|
| PubChem CID | 19085584 |
| Molecular Formula | C43H49N3O6 |
| Molecular Weight | 703.88 g/mol |
| Exact Mass | 703.36 |
| IUPAC Name | 4-[3-[4-[(4-methylphenyl)methoxy]-3-[3-[4-(2-propan-2-yloxyphenyl)piperazin-1-yl]propoxy]benzoyl]indol-1-yl]butanoic acid |
| SMILES | Cc1ccc(COc2ccc(C(=O)c3cn(CCCC(=O)O)c4ccccc34)cc2OCCCN2CCN(c3ccccc3OC(C)C)CC2)cc1 |
| InChI | InChI=1S/C43H49N3O6/c1-31(2)52-39-13-7-6-12-38(39)45-25-23-44(24-26-45)21-9-27-50-41-28-34(19-20-40(41)51-30-33-17-15-32(3)16-18-33)43(49)36-29-46(22-8-14-42(47)48)37-11-5-4-10-35(36)37/h4-7,10-13,15-20,28-29,31H,8-9,14,21-27,30H2,1-3H3,(H,47,48) |
| InChIKey | CGNQJHYXPHCPKR-UHFFFAOYSA-N |
| XLogP | 8.00 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.88 |
| LogP ≤ 5 | 8.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|