About 1,2,3-trimethyltriazinane
1,2,3-trimethyltriazinane (PubChem CID 19086133) has the molecular formula C6H15N3
and a molecular weight of 129.21 g/mol. Its IUPAC name is 1,2,3-trimethyltriazinane.
Molecular Properties
| Compound Name | 1,2,3-trimethyltriazinane |
| PubChem CID | 19086133 |
| Molecular Formula | C6H15N3 |
| Molecular Weight | 129.21 g/mol |
| Exact Mass | 129.13 |
| IUPAC Name | 1,2,3-trimethyltriazinane |
| SMILES | CN1CCCN(C)N1C |
| InChI | InChI=1S/C6H15N3/c1-7-5-4-6-8(2)9(7)3/h4-6H2,1-3H3 |
| InChIKey | HHPRAYYKBSMXAS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.21 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2,3-trimethyltriazinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2,3-trimethyltriazinane?
The IUPAC name of 1,2,3-trimethyltriazinane (CID 19086133) is 1,2,3-trimethyltriazinane.
What is the SMILES notation for 1,2,3-trimethyltriazinane?
The canonical SMILES for 1,2,3-trimethyltriazinane is CN1CCCN(C)N1C.
What is the InChIKey of 1,2,3-trimethyltriazinane?
The InChIKey is HHPRAYYKBSMXAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N3/c1-7-5-4-6-8(2)9(7)3/h4-6H2,1-3H3.
What are the key properties of 1,2,3-trimethyltriazinane?
1,2,3-trimethyltriazinane has a molecular weight of 129.21 g/mol, XLogP of 0.02, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2,3-trimethyltriazinane is sourced from PubChem (CID 19086133), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).