About cesium 2-methylpropane
cesium 2-methylpropane (PubChem CID 19086402) has the molecular formula C4H9Cs
and a molecular weight of 190.02 g/mol. Its IUPAC name is cesium 2-methylpropane.
Molecular Properties
| Compound Name | cesium 2-methylpropane |
| PubChem CID | 19086402 |
| Molecular Formula | C4H9Cs |
| Molecular Weight | 190.02 g/mol |
| Exact Mass | 189.98 |
| IUPAC Name | cesium 2-methylpropane |
| SMILES | C[C-](C)C.[Cs+] |
| InChI | InChI=1S/C4H9.Cs/c1-4(2)3;/h1-3H3;/q-1;+1 |
| InChIKey | ADRHZSNWEMEQJK-UHFFFAOYSA-N |
| XLogP | -1.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.02 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze cesium 2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cesium 2-methylpropane?
The IUPAC name of cesium 2-methylpropane (CID 19086402) is cesium 2-methylpropane.
What is the SMILES notation for cesium 2-methylpropane?
The canonical SMILES for cesium 2-methylpropane is C[C-](C)C.[Cs+].
What is the InChIKey of cesium 2-methylpropane?
The InChIKey is ADRHZSNWEMEQJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.Cs/c1-4(2)3;/h1-3H3;/q-1;+1.
What are the key properties of cesium 2-methylpropane?
cesium 2-methylpropane has a molecular weight of 190.02 g/mol, XLogP of -1.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cesium 2-methylpropane is sourced from PubChem (CID 19086402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).