C12H17I2N — CID 19086495
1-(2,4-diiodophenyl)-N-propan-2-ylpropan-2-amine (PubChem CID 19086495) has the molecular formula C12H17I2N and a molecular weight of 429.08 g/mol. Its IUPAC name is 1-(2,4-diiodophenyl)-N-propan-2-ylpropan-2-amine.
| Compound Name | 1-(2,4-diiodophenyl)-N-propan-2-ylpropan-2-amine |
|---|---|
| PubChem CID | 19086495 |
| Molecular Formula | C12H17I2N |
| Molecular Weight | 429.08 g/mol |
| Exact Mass | 428.95 |
| IUPAC Name | 1-(2,4-diiodophenyl)-N-propan-2-ylpropan-2-amine |
| SMILES | CC(C)NC(C)Cc1ccc(I)cc1I |
| InChI | InChI=1S/C12H17I2N/c1-8(2)15-9(3)6-10-4-5-11(13)7-12(10)14/h4-5,7-9,15H,6H2,1-3H3 |
| InChIKey | MNWXBFAZUPHTML-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.08 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|