C58H77O3P — CID 19087216
(6-tert-butylnaphthalen-2-yl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite (PubChem CID 19087216) has the molecular formula C58H77O3P and a molecular weight of 853.22 g/mol. Its IUPAC name is (6-tert-butylnaphthalen-2-yl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite.
| Compound Name | (6-tert-butylnaphthalen-2-yl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
|---|---|
| PubChem CID | 19087216 |
| Molecular Formula | C58H77O3P |
| Molecular Weight | 853.22 g/mol |
| Exact Mass | 852.56 |
| IUPAC Name | (6-tert-butylnaphthalen-2-yl) bis(3,6,8-tritert-butylnaphthalen-2-yl) phosphite |
| SMILES | CC(C)(C)c1ccc2cc(OP(Oc3cc4c(C(C)(C)C)cc(C(C)(C)C)cc4cc3C(C)(C)C)Oc3cc4c(C(C)(C)C)cc(C(C)(C)C)cc4cc3C(C)(C)C)ccc2c1 |
| InChI | InChI=1S/C58H77O3P/c1-52(2,3)40-24-22-37-29-43(25-23-36(37)26-40)59-62(60-50-34-44-38(30-48(50)57(16,17)18)27-41(53(4,5)6)32-46(44)55(10,11)12)61-51-35-45-39(31-49(51)58(19,20)21)28-42(54(7,8)9)33-47(45)56(13,14)15/h22-35H,1-21H3 |
| InChIKey | YSWHNIPNUFGGMV-UHFFFAOYSA-N |
| XLogP | 17.99 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 853.22 |
| LogP ≤ 5 | 17.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|