About [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite
[2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite (PubChem CID 19087229) has the molecular formula C42H49O3P-2
and a molecular weight of 632.83 g/mol. Its IUPAC name is [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite.
Molecular Properties
| Compound Name | [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite |
| PubChem CID | 19087229 |
| Molecular Formula | C42H49O3P-2 |
| Molecular Weight | 632.83 g/mol |
| Exact Mass | 632.34 |
| IUPAC Name | [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite |
| SMILES | CC(C)(C)c1ccc2cc(-c3cccc(OP([O-])[O-])c3-c3cc4ccc(C(C)(C)C)cc4cc3C(C)(C)C)c(C(C)(C)C)cc2c1 |
| InChI | InChI=1S/C42H49O3P/c1-39(2,3)30-18-16-26-22-33(35(41(7,8)9)24-28(26)20-30)32-14-13-15-37(45-46(43)44)38(32)34-23-27-17-19-31(40(4,5)6)21-29(27)25-36(34)42(10,11)12/h13-25H,1-12H3/q-2 |
| InChIKey | NWKAGHPMNXOTMM-UHFFFAOYSA-N |
| XLogP | 10.84 |
| TPSA | 55.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 632.83 |
| LogP ≤ 5 | 10.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite?
The IUPAC name of [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite (CID 19087229) is [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite.
What is the SMILES notation for [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite?
The canonical SMILES for [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite is CC(C)(C)c1ccc2cc(-c3cccc(OP([O-])[O-])c3-c3cc4ccc(C(C)(C)C)cc4cc3C(C)(C)C)c(C(C)(C)C)cc2c1.
What is the InChIKey of [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite?
The InChIKey is NWKAGHPMNXOTMM-UHFFFAOYSA-N. The full InChI is InChI=1S/C42H49O3P/c1-39(2,3)30-18-16-26-22-33(35(41(7,8)9)24-28(26)20-30)32-14-13-15-37(45-46(43)44)38(32)34-23-27-17-19-31(40(4,5)6)21-29(27)25-36(34)42(10,11)12/h13-25H,1-12H3/q-2.
What are the key properties of [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite?
[2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite has a molecular weight of 632.83 g/mol, XLogP of 10.84, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [2,3-bis(3,6-ditert-butylnaphthalen-2-yl)phenyl] phosphite is sourced from PubChem (CID 19087229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).