C27H34N2O6 — CID 19087658
2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4,5-dimethoxybenzoic acid (PubChem CID 19087658) has the molecular formula C27H34N2O6 and a molecular weight of 482.58 g/mol. Its IUPAC name is 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4,5-dimethoxybenzoic acid.
| Compound Name | 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4,5-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 19087658 |
| Molecular Formula | C27H34N2O6 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | 2-[ethoxycarbonyl-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]amino]-4,5-dimethoxybenzoic acid |
| SMILES | CCOC(=O)N(CCCCN1CC=C(c2ccccc2)CC1)c1cc(OC)c(OC)cc1C(=O)O |
| InChI | InChI=1S/C27H34N2O6/c1-4-35-27(32)29(23-19-25(34-3)24(33-2)18-22(23)26(30)31)15-9-8-14-28-16-12-21(13-17-28)20-10-6-5-7-11-20/h5-7,10-12,18-19H,4,8-9,13-17H2,1-3H3,(H,30,31) |
| InChIKey | LJWCCQXCIAFXCH-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 88.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|