C23H24ClN3O2 — CID 19087747
6-chloro-1-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]quinazoline-2,4-dione (PubChem CID 19087747) has the molecular formula C23H24ClN3O2 and a molecular weight of 409.92 g/mol. Its IUPAC name is 6-chloro-1-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]quinazoline-2,4-dione.
| Compound Name | 6-chloro-1-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]quinazoline-2,4-dione |
|---|---|
| PubChem CID | 19087747 |
| Molecular Formula | C23H24ClN3O2 |
| Molecular Weight | 409.92 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 6-chloro-1-[4-(4-phenyl-3,6-dihydro-2H-pyridin-1-yl)butyl]quinazoline-2,4-dione |
| SMILES | O=c1[nH]c(=O)n(CCCCN2CC=C(c3ccccc3)CC2)c2ccc(Cl)cc12 |
| InChI | InChI=1S/C23H24ClN3O2/c24-19-8-9-21-20(16-19)22(28)25-23(29)27(21)13-5-4-12-26-14-10-18(11-15-26)17-6-2-1-3-7-17/h1-3,6-10,16H,4-5,11-15H2,(H,25,28,29) |
| InChIKey | QHINLIIYAODBBW-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 58.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.92 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|