C20H26N2 — CID 19087928
1-(5-amino-2,4-dimethylphenyl)-1,3,3-trimethyl-2H-inden-5-amine (PubChem CID 19087928) has the molecular formula C20H26N2 and a molecular weight of 294.44 g/mol. Its IUPAC name is 1-(5-amino-2,4-dimethylphenyl)-1,3,3-trimethyl-2H-inden-5-amine.
| Compound Name | 1-(5-amino-2,4-dimethylphenyl)-1,3,3-trimethyl-2H-inden-5-amine |
|---|---|
| PubChem CID | 19087928 |
| Molecular Formula | C20H26N2 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.21 |
| IUPAC Name | 1-(5-amino-2,4-dimethylphenyl)-1,3,3-trimethyl-2H-inden-5-amine |
| SMILES | Cc1cc(C)c(C2(C)CC(C)(C)c3cc(N)ccc32)cc1N |
| InChI | InChI=1S/C20H26N2/c1-12-8-13(2)18(22)10-16(12)20(5)11-19(3,4)17-9-14(21)6-7-15(17)20/h6-10H,11,21-22H2,1-5H3 |
| InChIKey | RQLJHCRVLWHRBG-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|