C21H27IO2 — CID 19088027
1-(4-iodo-1-phenylbutyl)-2,5-dimethoxy-3,4,6-trimethylbenzene (PubChem CID 19088027) has the molecular formula C21H27IO2 and a molecular weight of 438.35 g/mol. Its IUPAC name is 1-(4-iodo-1-phenylbutyl)-2,5-dimethoxy-3,4,6-trimethylbenzene.
| Compound Name | 1-(4-iodo-1-phenylbutyl)-2,5-dimethoxy-3,4,6-trimethylbenzene |
|---|---|
| PubChem CID | 19088027 |
| Molecular Formula | C21H27IO2 |
| Molecular Weight | 438.35 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 1-(4-iodo-1-phenylbutyl)-2,5-dimethoxy-3,4,6-trimethylbenzene |
| SMILES | COc1c(C)c(C)c(OC)c(C(CCCI)c2ccccc2)c1C |
| InChI | InChI=1S/C21H27IO2/c1-14-15(2)21(24-5)19(16(3)20(14)23-4)18(12-9-13-22)17-10-7-6-8-11-17/h6-8,10-11,18H,9,12-13H2,1-5H3 |
| InChIKey | KXUBJGMYNQRMRZ-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.35 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|