C19H32O4 — CID 19088061
7-(1,4-dimethoxy-2,3,5-trimethylcyclohexa-2,4-dien-1-yl)octanoic acid (PubChem CID 19088061) has the molecular formula C19H32O4 and a molecular weight of 324.46 g/mol. Its IUPAC name is 7-(1,4-dimethoxy-2,3,5-trimethylcyclohexa-2,4-dien-1-yl)octanoic acid.
| Compound Name | 7-(1,4-dimethoxy-2,3,5-trimethylcyclohexa-2,4-dien-1-yl)octanoic acid |
|---|---|
| PubChem CID | 19088061 |
| Molecular Formula | C19H32O4 |
| Molecular Weight | 324.46 g/mol |
| Exact Mass | 324.23 |
| IUPAC Name | 7-(1,4-dimethoxy-2,3,5-trimethylcyclohexa-2,4-dien-1-yl)octanoic acid |
| SMILES | COC1=C(C)CC(OC)(C(C)CCCCCC(=O)O)C(C)=C1C |
| InChI | InChI=1S/C19H32O4/c1-13-12-19(23-6,16(4)15(3)18(13)22-5)14(2)10-8-7-9-11-17(20)21/h14H,7-12H2,1-6H3,(H,20,21) |
| InChIKey | ATZWTSFORUVJCM-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|