C17H24O4 — CID 19088066
7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid (PubChem CID 19088066) has the molecular formula C17H24O4 and a molecular weight of 292.38 g/mol. Its IUPAC name is 7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid.
| Compound Name | 7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid |
|---|---|
| PubChem CID | 19088066 |
| Molecular Formula | C17H24O4 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.17 |
| IUPAC Name | 7-(2,4,5-trimethyl-3,6-dioxocyclohexa-1,4-dien-1-yl)octanoic acid |
| SMILES | CC1=C(C)C(=O)C(C(C)CCCCCC(=O)O)=C(C)C1=O |
| InChI | InChI=1S/C17H24O4/c1-10(8-6-5-7-9-14(18)19)15-13(4)16(20)11(2)12(3)17(15)21/h10H,5-9H2,1-4H3,(H,18,19) |
| InChIKey | GXYYBDMYLBELNJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'chinone_1', 'substructure': 'N/A'} |
|---|