About 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one
1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one (PubChem CID 19088655) has the molecular formula C12H19N3O2Si
and a molecular weight of 265.39 g/mol. Its IUPAC name is 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one.
Molecular Properties
| Compound Name | 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one |
| PubChem CID | 19088655 |
| Molecular Formula | C12H19N3O2Si |
| Molecular Weight | 265.39 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one |
| SMILES | C[Si](C)(C)CCOCn1cnc2c(=O)[nH]ccc21 |
| InChI | InChI=1S/C12H19N3O2Si/c1-18(2,3)7-6-17-9-15-8-14-11-10(15)4-5-13-12(11)16/h4-5,8H,6-7,9H2,1-3H3,(H,13,16) |
| InChIKey | OQQAGNJVZAABIE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 59.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.39 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one?
The IUPAC name of 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one (CID 19088655) is 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one.
What is the SMILES notation for 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one?
The canonical SMILES for 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one is C[Si](C)(C)CCOCn1cnc2c(=O)[nH]ccc21.
What is the InChIKey of 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one?
The InChIKey is OQQAGNJVZAABIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2Si/c1-18(2,3)7-6-17-9-15-8-14-11-10(15)4-5-13-12(11)16/h4-5,8H,6-7,9H2,1-3H3,(H,13,16).
What are the key properties of 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one?
1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one has a molecular weight of 265.39 g/mol, XLogP of 2.04, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-trimethylsilylethoxymethyl)-5H-imidazo[4,5-c]pyridin-4-one is sourced from PubChem (CID 19088655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).