About 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile
1-methylimidazo[2,1-e]pyrazole-7-carbonitrile (PubChem CID 19089125) has the molecular formula C7H6N4
and a molecular weight of 146.15 g/mol. Its IUPAC name is 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile.
Molecular Properties
| Compound Name | 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile |
| PubChem CID | 19089125 |
| Molecular Formula | C7H6N4 |
| Molecular Weight | 146.15 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile |
| SMILES | Cn1ccn2ncc(C#N)c12 |
| InChI | InChI=1S/C7H6N4/c1-10-2-3-11-7(10)6(4-8)5-9-11/h2-3,5H,1H3 |
| InChIKey | OKRHNDXHPCRASP-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 46.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile?
The IUPAC name of 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile (CID 19089125) is 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile.
What is the SMILES notation for 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile?
The canonical SMILES for 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile is Cn1ccn2ncc(C#N)c12.
What is the InChIKey of 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile?
The InChIKey is OKRHNDXHPCRASP-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4/c1-10-2-3-11-7(10)6(4-8)5-9-11/h2-3,5H,1H3.
What are the key properties of 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile?
1-methylimidazo[2,1-e]pyrazole-7-carbonitrile has a molecular weight of 146.15 g/mol, XLogP of 0.54, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylimidazo[2,1-e]pyrazole-7-carbonitrile is sourced from PubChem (CID 19089125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).