C19H21NO — CID 19089138
5,10-dimethyl-10-azatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,13,15,17-hexaen-4-ol (PubChem CID 19089138) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 5,10-dimethyl-10-azatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,13,15,17-hexaen-4-ol.
| Compound Name | 5,10-dimethyl-10-azatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,13,15,17-hexaen-4-ol |
|---|---|
| PubChem CID | 19089138 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 5,10-dimethyl-10-azatetracyclo[9.7.0.02,7.013,18]octadeca-2(7),3,5,13,15,17-hexaen-4-ol |
| SMILES | Cc1cc2c(cc1O)C1c3ccccc3CC1N(C)CC2 |
| InChI | InChI=1S/C19H21NO/c1-12-9-14-7-8-20(2)17-10-13-5-3-4-6-15(13)19(17)16(14)11-18(12)21/h3-6,9,11,17,19,21H,7-8,10H2,1-2H3 |
| InChIKey | OCRCAVKXNOGOEK-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |