About 1-octylsulfonylnonane
1-octylsulfonylnonane (PubChem CID 19089492) has the molecular formula C17H36O2S
and a molecular weight of 304.54 g/mol. Its IUPAC name is 1-octylsulfonylnonane.
Molecular Properties
| Compound Name | 1-octylsulfonylnonane |
| PubChem CID | 19089492 |
| Molecular Formula | C17H36O2S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | 1-octylsulfonylnonane |
| SMILES | CCCCCCCCCS(=O)(=O)CCCCCCCC |
| InChI | InChI=1S/C17H36O2S/c1-3-5-7-9-11-13-15-17-20(18,19)16-14-12-10-8-6-4-2/h3-17H2,1-2H3 |
| InChIKey | SRTYYGNGYWDSKW-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-octylsulfonylnonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-octylsulfonylnonane?
The IUPAC name of 1-octylsulfonylnonane (CID 19089492) is 1-octylsulfonylnonane.
What is the SMILES notation for 1-octylsulfonylnonane?
The canonical SMILES for 1-octylsulfonylnonane is CCCCCCCCCS(=O)(=O)CCCCCCCC.
What is the InChIKey of 1-octylsulfonylnonane?
The InChIKey is SRTYYGNGYWDSKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H36O2S/c1-3-5-7-9-11-13-15-17-20(18,19)16-14-12-10-8-6-4-2/h3-17H2,1-2H3.
What are the key properties of 1-octylsulfonylnonane?
1-octylsulfonylnonane has a molecular weight of 304.54 g/mol, XLogP of 5.51, 15 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-octylsulfonylnonane is sourced from PubChem (CID 19089492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).